About triethoxy(nonyl)silane;triethoxy(octyl)silane
triethoxy(nonyl)silane;triethoxy(octyl)silane (PubChem CID 175508301) has the molecular formula C29H66O6Si2
and a molecular weight of 567.01 g/mol. Its IUPAC name is triethoxy(nonyl)silane;triethoxy(octyl)silane.
Molecular Properties
| Compound Name | triethoxy(nonyl)silane;triethoxy(octyl)silane |
| PubChem CID | 175508301 |
| Molecular Formula | C29H66O6Si2 |
| Molecular Weight | 567.01 g/mol |
| Exact Mass | 566.44 |
| IUPAC Name | triethoxy(nonyl)silane;triethoxy(octyl)silane |
| SMILES | CCCCCCCCC[Si](OCC)(OCC)OCC.CCCCCCCC[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C15H34O3Si.C14H32O3Si/c1-5-9-10-11-12-13-14-15-19(16-6-2,17-7-3)18-8-4;1-5-9-10-11-12-13-14-18(15-6-2,16-7-3)17-8-4/h5-15H2,1-4H3;5-14H2,1-4H3 |
| InChIKey | OTKUAUGIRMJYEO-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 567.01 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethoxy(nonyl)silane;triethoxy(octyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethoxy(nonyl)silane;triethoxy(octyl)silane?
The IUPAC name of triethoxy(nonyl)silane;triethoxy(octyl)silane (CID 175508301) is triethoxy(nonyl)silane;triethoxy(octyl)silane.
What is the SMILES notation for triethoxy(nonyl)silane;triethoxy(octyl)silane?
The canonical SMILES for triethoxy(nonyl)silane;triethoxy(octyl)silane is CCCCCCCCC[Si](OCC)(OCC)OCC.CCCCCCCC[Si](OCC)(OCC)OCC.
What is the InChIKey of triethoxy(nonyl)silane;triethoxy(octyl)silane?
The InChIKey is OTKUAUGIRMJYEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H34O3Si.C14H32O3Si/c1-5-9-10-11-12-13-14-15-19(16-6-2,17-7-3)18-8-4;1-5-9-10-11-12-13-14-18(15-6-2,16-7-3)17-8-4/h5-15H2,1-4H3;5-14H2,1-4H3.
What are the key properties of triethoxy(nonyl)silane;triethoxy(octyl)silane?
triethoxy(nonyl)silane;triethoxy(octyl)silane has a molecular weight of 567.01 g/mol, XLogP of 9.18, 27 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for triethoxy(nonyl)silane;triethoxy(octyl)silane is sourced from PubChem (CID 175508301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).