C12H26N2O3Si — CID 2760691
3-(2,4-dihydroimidazol-3-yl)propyl-triethoxysilane (PubChem CID 2760691) has the molecular formula C12H26N2O3Si and a molecular weight of 274.44 g/mol. Its IUPAC name is 3-(2,4-dihydroimidazol-3-yl)propyl-triethoxysilane.
| Compound Name | 3-(2,4-dihydroimidazol-3-yl)propyl-triethoxysilane |
|---|---|
| PubChem CID | 2760691 |
| Molecular Formula | C12H26N2O3Si |
| Molecular Weight | 274.44 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 3-(2,4-dihydroimidazol-3-yl)propyl-triethoxysilane |
| SMILES | CCO[Si](CCCN1CC=NC1)(OCC)OCC |
| InChI | InChI=1S/C12H26N2O3Si/c1-4-15-18(16-5-2,17-6-3)11-7-9-14-10-8-13-12-14/h8H,4-7,9-12H2,1-3H3 |
| InChIKey | NQUOMFKFPJKYPJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.44 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|