C12H15FN2O — CID 57285802
3-[3-(4-fluorophenoxy)propyl]-2,4-dihydroimidazole (PubChem CID 57285802) has the molecular formula C12H15FN2O and a molecular weight of 222.26 g/mol. Its IUPAC name is 3-[3-(4-fluorophenoxy)propyl]-2,4-dihydroimidazole.
| Compound Name | 3-[3-(4-fluorophenoxy)propyl]-2,4-dihydroimidazole |
|---|---|
| PubChem CID | 57285802 |
| Molecular Formula | C12H15FN2O |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 3-[3-(4-fluorophenoxy)propyl]-2,4-dihydroimidazole |
| SMILES | Fc1ccc(OCCCN2CC=NC2)cc1 |
| InChI | InChI=1S/C12H15FN2O/c13-11-2-4-12(5-3-11)16-9-1-7-15-8-6-14-10-15/h2-6H,1,7-10H2 |
| InChIKey | UJBZANQIKNFNPK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|