C16H23FN2O3 — CID 10710086
ethyl 4-[3-(4-fluorophenoxy)propyl]piperazine-1-carboxylate (PubChem CID 10710086) has the molecular formula C16H23FN2O3 and a molecular weight of 310.37 g/mol. Its IUPAC name is ethyl 4-[3-(4-fluorophenoxy)propyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-(4-fluorophenoxy)propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 10710086 |
| Molecular Formula | C16H23FN2O3 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | ethyl 4-[3-(4-fluorophenoxy)propyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(CCCOc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H23FN2O3/c1-2-21-16(20)19-11-9-18(10-12-19)8-3-13-22-15-6-4-14(17)5-7-15/h4-7H,2-3,8-13H2,1H3 |
| InChIKey | JSOHAFIHKJGIIB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|