C28H45N3O4 — CID 143132641
ethyl 4-[[4-[4-[3-(azepan-1-yl)propoxy]phenyl]oxan-4-yl]methyl]piperazine-1-carboxylate (PubChem CID 143132641) has the molecular formula C28H45N3O4 and a molecular weight of 487.69 g/mol. Its IUPAC name is ethyl 4-[[4-[4-[3-(azepan-1-yl)propoxy]phenyl]oxan-4-yl]methyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[[4-[4-[3-(azepan-1-yl)propoxy]phenyl]oxan-4-yl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 143132641 |
| Molecular Formula | C28H45N3O4 |
| Molecular Weight | 487.69 g/mol |
| Exact Mass | 487.34 |
| IUPAC Name | ethyl 4-[[4-[4-[3-(azepan-1-yl)propoxy]phenyl]oxan-4-yl]methyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(CC2(c3ccc(OCCCN4CCCCCC4)cc3)CCOCC2)CC1 |
| InChI | InChI=1S/C28H45N3O4/c1-2-34-27(32)31-19-17-30(18-20-31)24-28(12-22-33-23-13-28)25-8-10-26(11-9-25)35-21-7-16-29-14-5-3-4-6-15-29/h8-11H,2-7,12-24H2,1H3 |
| InChIKey | CMWZDZZDAZPLKB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 54.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.69 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|