C23H36N2O3S — CID 59837402
4-[[4-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]oxan-4-yl]methyl]-1,4-thiazinane 1-oxide (PubChem CID 59837402) has the molecular formula C23H36N2O3S and a molecular weight of 420.62 g/mol. Its IUPAC name is 4-[[4-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]oxan-4-yl]methyl]-1,4-thiazinane 1-oxide.
| Compound Name | 4-[[4-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]oxan-4-yl]methyl]-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 59837402 |
| Molecular Formula | C23H36N2O3S |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | 4-[[4-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]oxan-4-yl]methyl]-1,4-thiazinane 1-oxide |
| SMILES | O=S1CCN(CC2(c3ccc(OCCCN4CCCC4)cc3)CCOCC2)CC1 |
| InChI | InChI=1S/C23H36N2O3S/c26-29-18-13-25(14-19-29)20-23(8-16-27-17-9-23)21-4-6-22(7-5-21)28-15-3-12-24-10-1-2-11-24/h4-7H,1-3,8-20H2 |
| InChIKey | GPFPUDVCLGGWGZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|