C24H41N3O2 — CID 68576692
N,N,N'-trimethyl-N'-[[4-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]oxan-4-yl]methyl]ethane-1,2-diamine (PubChem CID 68576692) has the molecular formula C24H41N3O2 and a molecular weight of 403.61 g/mol. Its IUPAC name is N,N,N'-trimethyl-N'-[[4-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]oxan-4-yl]methyl]ethane-1,2-diamine.
| Compound Name | N,N,N'-trimethyl-N'-[[4-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]oxan-4-yl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 68576692 |
| Molecular Formula | C24H41N3O2 |
| Molecular Weight | 403.61 g/mol |
| Exact Mass | 403.32 |
| IUPAC Name | N,N,N'-trimethyl-N'-[[4-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]oxan-4-yl]methyl]ethane-1,2-diamine |
| SMILES | CN(C)CCN(C)CC1(c2ccc(OCCCN3CCCC3)cc2)CCOCC1 |
| InChI | InChI=1S/C24H41N3O2/c1-25(2)16-17-26(3)21-24(11-19-28-20-12-24)22-7-9-23(10-8-22)29-18-6-15-27-13-4-5-14-27/h7-10H,4-6,11-21H2,1-3H3 |
| InChIKey | JCODJTDKFILNIN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 28.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.61 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|