C24H39N3O4 — CID 59837463
ethyl 4-[3-[4-[4-[(dimethylamino)methyl]oxan-4-yl]phenoxy]propyl]piperazine-1-carboxylate (PubChem CID 59837463) has the molecular formula C24H39N3O4 and a molecular weight of 433.59 g/mol. Its IUPAC name is ethyl 4-[3-[4-[4-[(dimethylamino)methyl]oxan-4-yl]phenoxy]propyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-[4-[4-[(dimethylamino)methyl]oxan-4-yl]phenoxy]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 59837463 |
| Molecular Formula | C24H39N3O4 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.29 |
| IUPAC Name | ethyl 4-[3-[4-[4-[(dimethylamino)methyl]oxan-4-yl]phenoxy]propyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(CCCOc2ccc(C3(CN(C)C)CCOCC3)cc2)CC1 |
| InChI | InChI=1S/C24H39N3O4/c1-4-30-23(28)27-15-13-26(14-16-27)12-5-17-31-22-8-6-21(7-9-22)24(20-25(2)3)10-18-29-19-11-24/h6-9H,4-5,10-20H2,1-3H3 |
| InChIKey | IPRNLOHNFSNHMQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 54.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|