C25H38N4O2 — CID 173480711
(Z)-3-[1-[methyl-[[4-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]oxan-4-yl]methyl]amino]ethenylimino]prop-1-en-1-amine (PubChem CID 173480711) has the molecular formula C25H38N4O2 and a molecular weight of 426.61 g/mol. Its IUPAC name is (Z)-3-[1-[methyl-[[4-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]oxan-4-yl]methyl]amino]ethenylimino]prop-1-en-1-amine.
| Compound Name | (Z)-3-[1-[methyl-[[4-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]oxan-4-yl]methyl]amino]ethenylimino]prop-1-en-1-amine |
|---|---|
| PubChem CID | 173480711 |
| Molecular Formula | C25H38N4O2 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | (Z)-3-[1-[methyl-[[4-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]oxan-4-yl]methyl]amino]ethenylimino]prop-1-en-1-amine |
| SMILES | C=C(N=C/C=C\N)N(C)CC1(c2ccc(OCCCN3CCCC3)cc2)CCOCC1 |
| InChI | InChI=1S/C25H38N4O2/c1-22(27-14-5-13-26)28(2)21-25(11-19-30-20-12-25)23-7-9-24(10-8-23)31-18-6-17-29-15-3-4-16-29/h5,7-10,13-14H,1,3-4,6,11-12,15-21,26H2,2H3/b13-5-,27-14? |
| InChIKey | KVQOYQJYSJORPQ-FQWGNNOASA-N |
| XLogP | 3.55 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|