C22H33N3O3 — CID 68578480
N-(dimethylaminomethylidene)-4-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]oxane-4-carboxamide (PubChem CID 68578480) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is N-(dimethylaminomethylidene)-4-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]oxane-4-carboxamide.
| Compound Name | N-(dimethylaminomethylidene)-4-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 68578480 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | N-(dimethylaminomethylidene)-4-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]oxane-4-carboxamide |
| SMILES | CN(C)/C=N/C(=O)C1(c2ccc(OCCCN3CCCC3)cc2)CCOCC1 |
| InChI | InChI=1S/C22H33N3O3/c1-24(2)18-23-21(26)22(10-16-27-17-11-22)19-6-8-20(9-7-19)28-15-5-14-25-12-3-4-13-25/h6-9,18H,3-5,10-17H2,1-2H3/b23-18+ |
| InChIKey | GCFOTEQSOJNWNC-PTGBLXJZSA-N |
| XLogP | 2.72 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|