C21H34N4O5 — CID 68578687
guanidine;4-[4-[3-(1,4-oxazepan-4-yl)propoxy]phenyl]oxane-4-carboxylic acid (PubChem CID 68578687) has the molecular formula C21H34N4O5 and a molecular weight of 422.53 g/mol. Its IUPAC name is guanidine;4-[4-[3-(1,4-oxazepan-4-yl)propoxy]phenyl]oxane-4-carboxylic acid.
| Compound Name | guanidine;4-[4-[3-(1,4-oxazepan-4-yl)propoxy]phenyl]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 68578687 |
| Molecular Formula | C21H34N4O5 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | guanidine;4-[4-[3-(1,4-oxazepan-4-yl)propoxy]phenyl]oxane-4-carboxylic acid |
| SMILES | O=C(O)C1(c2ccc(OCCCN3CCCOCC3)cc2)CCOCC1.[H]N=C(N)N |
| InChI | InChI=1S/C20H29NO5.CH5N3/c22-19(23)20(7-14-25-15-8-20)17-3-5-18(6-4-17)26-13-2-10-21-9-1-12-24-16-11-21;2-1(3)4/h3-6H,1-2,7-16H2,(H,22,23);(H5,2,3,4) |
| InChIKey | FCBZVCMGJDVFCZ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 144.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|