C15H21NO4 — CID 63075111
3-[3-(1,4-oxazepan-4-yl)propoxy]benzoic acid (PubChem CID 63075111) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-[3-(1,4-oxazepan-4-yl)propoxy]benzoic acid.
| Compound Name | 3-[3-(1,4-oxazepan-4-yl)propoxy]benzoic acid |
|---|---|
| PubChem CID | 63075111 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 3-[3-(1,4-oxazepan-4-yl)propoxy]benzoic acid |
| SMILES | O=C(O)c1cccc(OCCCN2CCCOCC2)c1 |
| InChI | InChI=1S/C15H21NO4/c17-15(18)13-4-1-5-14(12-13)20-10-3-7-16-6-2-9-19-11-8-16/h1,4-5,12H,2-3,6-11H2,(H,17,18) |
| InChIKey | TUYMGCFTTKDWHP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|