C21H27N3O3 — CID 21451803
(3,4-diaminophenyl)-[3-(4-morpholin-4-ylbutoxy)phenyl]methanone (PubChem CID 21451803) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is (3,4-diaminophenyl)-[3-(4-morpholin-4-ylbutoxy)phenyl]methanone.
| Compound Name | (3,4-diaminophenyl)-[3-(4-morpholin-4-ylbutoxy)phenyl]methanone |
|---|---|
| PubChem CID | 21451803 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | (3,4-diaminophenyl)-[3-(4-morpholin-4-ylbutoxy)phenyl]methanone |
| SMILES | Nc1ccc(C(=O)c2cccc(OCCCCN3CCOCC3)c2)cc1N |
| InChI | InChI=1S/C21H27N3O3/c22-19-7-6-17(15-20(19)23)21(25)16-4-3-5-18(14-16)27-11-2-1-8-24-9-12-26-13-10-24/h3-7,14-15H,1-2,8-13,22-23H2 |
| InChIKey | DDFHFRRPGGFOGB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|