C24H39N3O3 — CID 68579025
azane;(2,2-dimethylazetidin-1-yl)-[4-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]oxan-4-yl]methanone (PubChem CID 68579025) has the molecular formula C24H39N3O3 and a molecular weight of 417.59 g/mol. Its IUPAC name is azane;(2,2-dimethylazetidin-1-yl)-[4-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]oxan-4-yl]methanone.
| Compound Name | azane;(2,2-dimethylazetidin-1-yl)-[4-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]oxan-4-yl]methanone |
|---|---|
| PubChem CID | 68579025 |
| Molecular Formula | C24H39N3O3 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.30 |
| IUPAC Name | azane;(2,2-dimethylazetidin-1-yl)-[4-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]oxan-4-yl]methanone |
| SMILES | CC1(C)CCN1C(=O)C1(c2ccc(OCCCN3CCCC3)cc2)CCOCC1.N |
| InChI | InChI=1S/C24H36N2O3.H3N/c1-23(2)10-16-26(23)22(27)24(11-18-28-19-12-24)20-6-8-21(9-7-20)29-17-5-15-25-13-3-4-14-25;/h6-9H,3-5,10-19H2,1-2H3;1H3 |
| InChIKey | JESJBYCPLHREEE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 77.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|