C25H38N2O3 — CID 68576312
(4-hydroxypiperidin-1-yl)-[1-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]cyclohexyl]methanone (PubChem CID 68576312) has the molecular formula C25H38N2O3 and a molecular weight of 414.59 g/mol. Its IUPAC name is (4-hydroxypiperidin-1-yl)-[1-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]cyclohexyl]methanone.
| Compound Name | (4-hydroxypiperidin-1-yl)-[1-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]cyclohexyl]methanone |
|---|---|
| PubChem CID | 68576312 |
| Molecular Formula | C25H38N2O3 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.29 |
| IUPAC Name | (4-hydroxypiperidin-1-yl)-[1-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]cyclohexyl]methanone |
| SMILES | O=C(N1CCC(O)CC1)C1(c2ccc(OCCCN3CCCC3)cc2)CCCCC1 |
| InChI | InChI=1S/C25H38N2O3/c28-22-11-18-27(19-12-22)24(29)25(13-2-1-3-14-25)21-7-9-23(10-8-21)30-20-6-17-26-15-4-5-16-26/h7-10,22,28H,1-6,11-20H2 |
| InChIKey | VRAGVBCCRBNHNZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|