C20H29FN2O2 — CID 12050260
N-cyclopropyl-N-[1-[3-(4-fluorophenoxy)propyl]piperidin-4-yl]propanamide (PubChem CID 12050260) has the molecular formula C20H29FN2O2 and a molecular weight of 348.46 g/mol. Its IUPAC name is N-cyclopropyl-N-[1-[3-(4-fluorophenoxy)propyl]piperidin-4-yl]propanamide.
| Compound Name | N-cyclopropyl-N-[1-[3-(4-fluorophenoxy)propyl]piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 12050260 |
| Molecular Formula | C20H29FN2O2 |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | N-cyclopropyl-N-[1-[3-(4-fluorophenoxy)propyl]piperidin-4-yl]propanamide |
| SMILES | CCC(=O)N(C1CC1)C1CCN(CCCOc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H29FN2O2/c1-2-20(24)23(17-6-7-17)18-10-13-22(14-11-18)12-3-15-25-19-8-4-16(21)5-9-19/h4-5,8-9,17-18H,2-3,6-7,10-15H2,1H3 |
| InChIKey | RFFNDOXANROJEP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|