C29H31F2NO2 — CID 14407097
1-[4-[3-[4-[bis(4-fluorophenyl)methyl]piperidin-1-yl]propoxy]phenyl]ethanone (PubChem CID 14407097) has the molecular formula C29H31F2NO2 and a molecular weight of 463.57 g/mol. Its IUPAC name is 1-[4-[3-[4-[bis(4-fluorophenyl)methyl]piperidin-1-yl]propoxy]phenyl]ethanone.
| Compound Name | 1-[4-[3-[4-[bis(4-fluorophenyl)methyl]piperidin-1-yl]propoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 14407097 |
| Molecular Formula | C29H31F2NO2 |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | 1-[4-[3-[4-[bis(4-fluorophenyl)methyl]piperidin-1-yl]propoxy]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(OCCCN2CCC(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C29H31F2NO2/c1-21(33)22-7-13-28(14-8-22)34-20-2-17-32-18-15-25(16-19-32)29(23-3-9-26(30)10-4-23)24-5-11-27(31)12-6-24/h3-14,25,29H,2,15-20H2,1H3 |
| InChIKey | WQUFWOXKBAQRQU-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|