C31H36F2N2O2 — CID 19772098
1-[4-[3-[4-[(4-fluoroanilino)-(4-fluorophenyl)methyl]piperidin-1-yl]propoxy]phenyl]-2-methylpropan-1-one (PubChem CID 19772098) has the molecular formula C31H36F2N2O2 and a molecular weight of 506.64 g/mol. Its IUPAC name is 1-[4-[3-[4-[(4-fluoroanilino)-(4-fluorophenyl)methyl]piperidin-1-yl]propoxy]phenyl]-2-methylpropan-1-one.
| Compound Name | 1-[4-[3-[4-[(4-fluoroanilino)-(4-fluorophenyl)methyl]piperidin-1-yl]propoxy]phenyl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 19772098 |
| Molecular Formula | C31H36F2N2O2 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | 1-[4-[3-[4-[(4-fluoroanilino)-(4-fluorophenyl)methyl]piperidin-1-yl]propoxy]phenyl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)c1ccc(OCCCN2CCC(C(Nc3ccc(F)cc3)c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C31H36F2N2O2/c1-22(2)31(36)25-6-14-29(15-7-25)37-21-3-18-35-19-16-24(17-20-35)30(23-4-8-26(32)9-5-23)34-28-12-10-27(33)11-13-28/h4-15,22,24,30,34H,3,16-21H2,1-2H3 |
| InChIKey | GFPYDXANPHWMJX-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|