C30H33F2NO3 — CID 15093874
1-[4-[3-[4-[bis(4-fluorophenyl)methyl]piperidin-1-yl]propoxy]-2-methoxyphenyl]ethanone (PubChem CID 15093874) has the molecular formula C30H33F2NO3 and a molecular weight of 493.59 g/mol. Its IUPAC name is 1-[4-[3-[4-[bis(4-fluorophenyl)methyl]piperidin-1-yl]propoxy]-2-methoxyphenyl]ethanone.
| Compound Name | 1-[4-[3-[4-[bis(4-fluorophenyl)methyl]piperidin-1-yl]propoxy]-2-methoxyphenyl]ethanone |
|---|---|
| PubChem CID | 15093874 |
| Molecular Formula | C30H33F2NO3 |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | 1-[4-[3-[4-[bis(4-fluorophenyl)methyl]piperidin-1-yl]propoxy]-2-methoxyphenyl]ethanone |
| SMILES | COc1cc(OCCCN2CCC(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)ccc1C(C)=O |
| InChI | InChI=1S/C30H33F2NO3/c1-21(34)28-13-12-27(20-29(28)35-2)36-19-3-16-33-17-14-24(15-18-33)30(22-4-8-25(31)9-5-22)23-6-10-26(32)11-7-23/h4-13,20,24,30H,3,14-19H2,1-2H3 |
| InChIKey | FKRCUXNEGDSKAA-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|