C30H31F4NO3 — CID 15093862
1-[4-[3-[4-[bis(2,4-difluorophenyl)methyl]piperidin-1-yl]propoxy]-3-methoxyphenyl]ethanone (PubChem CID 15093862) has the molecular formula C30H31F4NO3 and a molecular weight of 529.57 g/mol. Its IUPAC name is 1-[4-[3-[4-[bis(2,4-difluorophenyl)methyl]piperidin-1-yl]propoxy]-3-methoxyphenyl]ethanone.
| Compound Name | 1-[4-[3-[4-[bis(2,4-difluorophenyl)methyl]piperidin-1-yl]propoxy]-3-methoxyphenyl]ethanone |
|---|---|
| PubChem CID | 15093862 |
| Molecular Formula | C30H31F4NO3 |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | 1-[4-[3-[4-[bis(2,4-difluorophenyl)methyl]piperidin-1-yl]propoxy]-3-methoxyphenyl]ethanone |
| SMILES | COc1cc(C(C)=O)ccc1OCCCN1CCC(C(c2ccc(F)cc2F)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C30H31F4NO3/c1-19(36)21-4-9-28(29(16-21)37-2)38-15-3-12-35-13-10-20(11-14-35)30(24-7-5-22(31)17-26(24)33)25-8-6-23(32)18-27(25)34/h4-9,16-18,20,30H,3,10-15H2,1-2H3 |
| InChIKey | HPUPORXOVFFDTA-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|