C66H70F4N4O12 — CID 57267127
bis[2-(N-[[1-[3-(4-acetyl-2-methoxyphenoxy)propyl]piperidin-4-yl]-(4-fluorophenyl)methyl]-4-fluoroanilino)-2-oxoethyl] oxalate (PubChem CID 57267127) has the molecular formula C66H70F4N4O12 and a molecular weight of 1187.29 g/mol. Its IUPAC name is bis[2-(N-[[1-[3-(4-acetyl-2-methoxyphenoxy)propyl]piperidin-4-yl]-(4-fluorophenyl)methyl]-4-fluoroanilino)-2-oxoethyl] oxalate.
| Compound Name | bis[2-(N-[[1-[3-(4-acetyl-2-methoxyphenoxy)propyl]piperidin-4-yl]-(4-fluorophenyl)methyl]-4-fluoroanilino)-2-oxoethyl] oxalate |
|---|---|
| PubChem CID | 57267127 |
| Molecular Formula | C66H70F4N4O12 |
| Molecular Weight | 1187.29 g/mol |
| Exact Mass | 1186.49 |
| IUPAC Name | bis[2-(N-[[1-[3-(4-acetyl-2-methoxyphenoxy)propyl]piperidin-4-yl]-(4-fluorophenyl)methyl]-4-fluoroanilino)-2-oxoethyl] oxalate |
| SMILES | COc1cc(C(C)=O)ccc1OCCCN1CCC(C(c2ccc(F)cc2)N(C(=O)COC(=O)C(=O)OCC(=O)N(c2ccc(F)cc2)C(c2ccc(F)cc2)C2CCN(CCCOc3ccc(C(C)=O)cc3OC)CC2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C66H70F4N4O12/c1-43(75)49-11-25-57(59(39-49)81-3)83-37-5-31-71-33-27-47(28-34-71)63(45-7-13-51(67)14-8-45)73(55-21-17-53(69)18-22-55)61(77)41-85-65(79)66(80)86-42-62(78)74(56-23-19-54(70)20-24-56)64(46-9-15-52(68)16-10-46)48-29-35-72(36-30-48)32-6-38-84-58-26-12-50(44(2)76)40-60(58)82-4/h7-26,39-40,47-48,63-64H,5-6,27-38,41-42H2,1-4H3 |
| InChIKey | UDCTYLFEELMYJG-UHFFFAOYSA-N |
| XLogP | 10.96 |
| TPSA | 170.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 86 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1187.29 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|