C25H30F2N2O4 — CID 123530053
1-[4-[3-[4-[(2,4-difluorophenyl)-nitrosomethyl]piperidin-1-yl]propoxy]-3-ethoxyphenyl]ethanone (PubChem CID 123530053) has the molecular formula C25H30F2N2O4 and a molecular weight of 460.52 g/mol. Its IUPAC name is 1-[4-[3-[4-[(2,4-difluorophenyl)-nitrosomethyl]piperidin-1-yl]propoxy]-3-ethoxyphenyl]ethanone.
| Compound Name | 1-[4-[3-[4-[(2,4-difluorophenyl)-nitrosomethyl]piperidin-1-yl]propoxy]-3-ethoxyphenyl]ethanone |
|---|---|
| PubChem CID | 123530053 |
| Molecular Formula | C25H30F2N2O4 |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 1-[4-[3-[4-[(2,4-difluorophenyl)-nitrosomethyl]piperidin-1-yl]propoxy]-3-ethoxyphenyl]ethanone |
| SMILES | CCOc1cc(C(C)=O)ccc1OCCCN1CCC(C(N=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C25H30F2N2O4/c1-3-32-24-15-19(17(2)30)5-8-23(24)33-14-4-11-29-12-9-18(10-13-29)25(28-31)21-7-6-20(26)16-22(21)27/h5-8,15-16,18,25H,3-4,9-14H2,1-2H3 |
| InChIKey | CBVFMROLSYULOC-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|