C30H32FN3O3 — CID 14407150
2-[1-[3-(4-acetyl-2-methoxyphenoxy)propyl]piperidin-4-yl]-2-(4-fluorophenyl)-2-pyridin-2-ylacetonitrile (PubChem CID 14407150) has the molecular formula C30H32FN3O3 and a molecular weight of 501.60 g/mol. Its IUPAC name is 2-[1-[3-(4-acetyl-2-methoxyphenoxy)propyl]piperidin-4-yl]-2-(4-fluorophenyl)-2-pyridin-2-ylacetonitrile.
| Compound Name | 2-[1-[3-(4-acetyl-2-methoxyphenoxy)propyl]piperidin-4-yl]-2-(4-fluorophenyl)-2-pyridin-2-ylacetonitrile |
|---|---|
| PubChem CID | 14407150 |
| Molecular Formula | C30H32FN3O3 |
| Molecular Weight | 501.60 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | 2-[1-[3-(4-acetyl-2-methoxyphenoxy)propyl]piperidin-4-yl]-2-(4-fluorophenyl)-2-pyridin-2-ylacetonitrile |
| SMILES | COc1cc(C(C)=O)ccc1OCCCN1CCC(C(C#N)(c2ccc(F)cc2)c2ccccn2)CC1 |
| InChI | InChI=1S/C30H32FN3O3/c1-22(35)23-7-12-27(28(20-23)36-2)37-19-5-16-34-17-13-25(14-18-34)30(21-32,29-6-3-4-15-33-29)24-8-10-26(31)11-9-24/h3-4,6-12,15,20,25H,5,13-14,16-19H2,1-2H3 |
| InChIKey | AAXFMSOAJGYRSJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 75.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.60 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|