C31H32FN3O4 — CID 18973226
1-[4-[3-[4-(1-benzoyl-6-fluoroindazol-3-yl)piperidin-1-yl]propoxy]-3-methoxyphenyl]ethanone (PubChem CID 18973226) has the molecular formula C31H32FN3O4 and a molecular weight of 529.61 g/mol. Its IUPAC name is 1-[4-[3-[4-(1-benzoyl-6-fluoroindazol-3-yl)piperidin-1-yl]propoxy]-3-methoxyphenyl]ethanone.
| Compound Name | 1-[4-[3-[4-(1-benzoyl-6-fluoroindazol-3-yl)piperidin-1-yl]propoxy]-3-methoxyphenyl]ethanone |
|---|---|
| PubChem CID | 18973226 |
| Molecular Formula | C31H32FN3O4 |
| Molecular Weight | 529.61 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | 1-[4-[3-[4-(1-benzoyl-6-fluoroindazol-3-yl)piperidin-1-yl]propoxy]-3-methoxyphenyl]ethanone |
| SMILES | COc1cc(C(C)=O)ccc1OCCCN1CCC(c2nn(C(=O)c3ccccc3)c3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C31H32FN3O4/c1-21(36)24-9-12-28(29(19-24)38-2)39-18-6-15-34-16-13-22(14-17-34)30-26-11-10-25(32)20-27(26)35(33-30)31(37)23-7-4-3-5-8-23/h3-5,7-12,19-20,22H,6,13-18H2,1-2H3 |
| InChIKey | IBGVDHVBSYEHKM-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.61 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|