C23H27FN4O3 — CID 23362256
1-[4-[3-[4-(6-fluoroindazol-1-yl)piperazin-1-yl]propoxy]-3-methoxyphenyl]ethanone (PubChem CID 23362256) has the molecular formula C23H27FN4O3 and a molecular weight of 426.49 g/mol. Its IUPAC name is 1-[4-[3-[4-(6-fluoroindazol-1-yl)piperazin-1-yl]propoxy]-3-methoxyphenyl]ethanone.
| Compound Name | 1-[4-[3-[4-(6-fluoroindazol-1-yl)piperazin-1-yl]propoxy]-3-methoxyphenyl]ethanone |
|---|---|
| PubChem CID | 23362256 |
| Molecular Formula | C23H27FN4O3 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 1-[4-[3-[4-(6-fluoroindazol-1-yl)piperazin-1-yl]propoxy]-3-methoxyphenyl]ethanone |
| SMILES | COc1cc(C(C)=O)ccc1OCCCN1CCN(n2ncc3ccc(F)cc32)CC1 |
| InChI | InChI=1S/C23H27FN4O3/c1-17(29)18-5-7-22(23(14-18)30-2)31-13-3-8-26-9-11-27(12-10-26)28-21-15-20(24)6-4-19(21)16-25-28/h4-7,14-16H,3,8-13H2,1-2H3 |
| InChIKey | ORKLAJAFBLHALM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 59.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|