C60H60F4N2O8 — CID 88615259
bis[[1-[3-(3-acetylphenoxy)propyl]piperidin-4-yl]-bis(4-fluorophenyl)methyl] oxalate (PubChem CID 88615259) has the molecular formula C60H60F4N2O8 and a molecular weight of 1013.14 g/mol. Its IUPAC name is bis[[1-[3-(3-acetylphenoxy)propyl]piperidin-4-yl]-bis(4-fluorophenyl)methyl] oxalate.
| Compound Name | bis[[1-[3-(3-acetylphenoxy)propyl]piperidin-4-yl]-bis(4-fluorophenyl)methyl] oxalate |
|---|---|
| PubChem CID | 88615259 |
| Molecular Formula | C60H60F4N2O8 |
| Molecular Weight | 1013.14 g/mol |
| Exact Mass | 1012.43 |
| IUPAC Name | bis[[1-[3-(3-acetylphenoxy)propyl]piperidin-4-yl]-bis(4-fluorophenyl)methyl] oxalate |
| SMILES | CC(=O)c1cccc(OCCCN2CCC(C(OC(=O)C(=O)OC(c3ccc(F)cc3)(c3ccc(F)cc3)C3CCN(CCCOc4cccc(C(C)=O)c4)CC3)(c3ccc(F)cc3)c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C60H60F4N2O8/c1-41(67)43-7-3-9-55(39-43)71-37-5-31-65-33-27-49(28-34-65)59(45-11-19-51(61)20-12-45,46-13-21-52(62)22-14-46)73-57(69)58(70)74-60(47-15-23-53(63)24-16-47,48-17-25-54(64)26-18-48)50-29-35-66(36-30-50)32-6-38-72-56-10-4-8-44(40-56)42(2)68/h3-4,7-26,39-40,49-50H,5-6,27-38H2,1-2H3 |
| InChIKey | CYSZKFRMSADHPH-UHFFFAOYSA-N |
| XLogP | 11.28 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1013.14 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|