C31H34F3NO6 — CID 53300849
methyl 3-[3-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]propoxy]benzoate;2,2,2-trifluoroacetic acid (PubChem CID 53300849) has the molecular formula C31H34F3NO6 and a molecular weight of 573.61 g/mol. Its IUPAC name is methyl 3-[3-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]propoxy]benzoate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl 3-[3-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]propoxy]benzoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 53300849 |
| Molecular Formula | C31H34F3NO6 |
| Molecular Weight | 573.61 g/mol |
| Exact Mass | 573.23 |
| IUPAC Name | methyl 3-[3-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]propoxy]benzoate;2,2,2-trifluoroacetic acid |
| SMILES | COC(=O)c1cccc(OCCCN2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C29H33NO4.C2HF3O2/c1-33-28(31)23-10-8-15-27(22-23)34-21-9-18-30-19-16-26(17-20-30)29(32,24-11-4-2-5-12-24)25-13-6-3-7-14-25;3-2(4,5)1(6)7/h2-8,10-15,22,26,32H,9,16-21H2,1H3;(H,6,7) |
| InChIKey | GBMDZBLQQMBRTB-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.61 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|