C29H33NO4 — CID 51049667
methyl 3-[3-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]propoxy]benzoate (PubChem CID 51049667) has the molecular formula C29H33NO4 and a molecular weight of 459.59 g/mol. Its IUPAC name is methyl 3-[3-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]propoxy]benzoate.
| Compound Name | methyl 3-[3-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]propoxy]benzoate |
|---|---|
| PubChem CID | 51049667 |
| Molecular Formula | C29H33NO4 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | methyl 3-[3-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]propoxy]benzoate |
| SMILES | COC(=O)c1cccc(OCCCN2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C29H33NO4/c1-33-28(31)23-10-8-15-27(22-23)34-21-9-18-30-19-16-26(17-20-30)29(32,24-11-4-2-5-12-24)25-13-6-3-7-14-25/h2-8,10-15,22,26,32H,9,16-21H2,1H3 |
| InChIKey | QRHGBMONZOGJMO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|