C30H33F2NO4 — CID 14407140
1-[4-[3-[4-[bis(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]propoxy]-2-methoxyphenyl]ethanone (PubChem CID 14407140) has the molecular formula C30H33F2NO4 and a molecular weight of 509.59 g/mol. Its IUPAC name is 1-[4-[3-[4-[bis(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]propoxy]-2-methoxyphenyl]ethanone.
| Compound Name | 1-[4-[3-[4-[bis(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]propoxy]-2-methoxyphenyl]ethanone |
|---|---|
| PubChem CID | 14407140 |
| Molecular Formula | C30H33F2NO4 |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | 1-[4-[3-[4-[bis(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]propoxy]-2-methoxyphenyl]ethanone |
| SMILES | COc1cc(OCCCN2CCC(C(O)(c3ccc(F)cc3)c3ccc(F)cc3)CC2)ccc1C(C)=O |
| InChI | InChI=1S/C30H33F2NO4/c1-21(34)28-13-12-27(20-29(28)36-2)37-19-3-16-33-17-14-24(15-18-33)30(35,22-4-8-25(31)9-5-22)23-6-10-26(32)11-7-23/h4-13,20,24,35H,3,14-19H2,1-2H3 |
| InChIKey | ZEBXFCFWCGBFOZ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|