C37H39F2NO6 — CID 15020369
benzyl 2-[4-[3-[4-[bis(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]propoxy]-3-methoxyphenyl]-2-hydroxyacetate (PubChem CID 15020369) has the molecular formula C37H39F2NO6 and a molecular weight of 631.72 g/mol. Its IUPAC name is benzyl 2-[4-[3-[4-[bis(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]propoxy]-3-methoxyphenyl]-2-hydroxyacetate.
| Compound Name | benzyl 2-[4-[3-[4-[bis(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]propoxy]-3-methoxyphenyl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 15020369 |
| Molecular Formula | C37H39F2NO6 |
| Molecular Weight | 631.72 g/mol |
| Exact Mass | 631.27 |
| IUPAC Name | benzyl 2-[4-[3-[4-[bis(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]propoxy]-3-methoxyphenyl]-2-hydroxyacetate |
| SMILES | COc1cc(C(O)C(=O)OCc2ccccc2)ccc1OCCCN1CCC(C(O)(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C37H39F2NO6/c1-44-34-24-27(35(41)36(42)46-25-26-6-3-2-4-7-26)8-17-33(34)45-23-5-20-40-21-18-30(19-22-40)37(43,28-9-13-31(38)14-10-28)29-11-15-32(39)16-12-29/h2-4,6-17,24,30,35,41,43H,5,18-23,25H2,1H3 |
| InChIKey | OMZJVJMRHXYVRK-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.72 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|