C30H35NO7 — CID 45104642
benzyl 4-[bis(3,4-dimethoxyphenyl)-hydroxymethyl]piperidine-1-carboxylate (PubChem CID 45104642) has the molecular formula C30H35NO7 and a molecular weight of 521.61 g/mol. Its IUPAC name is benzyl 4-[bis(3,4-dimethoxyphenyl)-hydroxymethyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[bis(3,4-dimethoxyphenyl)-hydroxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 45104642 |
| Molecular Formula | C30H35NO7 |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | benzyl 4-[bis(3,4-dimethoxyphenyl)-hydroxymethyl]piperidine-1-carboxylate |
| SMILES | COc1ccc(C(O)(c2ccc(OC)c(OC)c2)C2CCN(C(=O)OCc3ccccc3)CC2)cc1OC |
| InChI | InChI=1S/C30H35NO7/c1-34-25-12-10-23(18-27(25)36-3)30(33,24-11-13-26(35-2)28(19-24)37-4)22-14-16-31(17-15-22)29(32)38-20-21-8-6-5-7-9-21/h5-13,18-19,22,33H,14-17,20H2,1-4H3 |
| InChIKey | FDUKFXCFBWZQFN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |