C23H27NO5 — CID 166624647
benzyl 4-[(5-acetyl-2-methoxyphenoxy)methyl]piperidine-1-carboxylate (PubChem CID 166624647) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is benzyl 4-[(5-acetyl-2-methoxyphenoxy)methyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[(5-acetyl-2-methoxyphenoxy)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166624647 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | benzyl 4-[(5-acetyl-2-methoxyphenoxy)methyl]piperidine-1-carboxylate |
| SMILES | COc1ccc(C(C)=O)cc1OCC1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H27NO5/c1-17(25)20-8-9-21(27-2)22(14-20)28-15-19-10-12-24(13-11-19)23(26)29-16-18-6-4-3-5-7-18/h3-9,14,19H,10-13,15-16H2,1-2H3 |
| InChIKey | PAFDZJZJRLUHEY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |