C25H32F2N2O3 — CID 15042256
5-[4-[bis(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]pentyl N-methylcarbamate (PubChem CID 15042256) has the molecular formula C25H32F2N2O3 and a molecular weight of 446.54 g/mol. Its IUPAC name is 5-[4-[bis(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]pentyl N-methylcarbamate.
| Compound Name | 5-[4-[bis(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]pentyl N-methylcarbamate |
|---|---|
| PubChem CID | 15042256 |
| Molecular Formula | C25H32F2N2O3 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 5-[4-[bis(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]pentyl N-methylcarbamate |
| SMILES | CNC(=O)OCCCCCN1CCC(C(O)(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C25H32F2N2O3/c1-28-24(30)32-18-4-2-3-15-29-16-13-21(14-17-29)25(31,19-5-9-22(26)10-6-19)20-7-11-23(27)12-8-20/h5-12,21,31H,2-4,13-18H2,1H3,(H,28,30) |
| InChIKey | BRGYZWPZVLNGAT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|