C29H31F2NO6 — CID 23036403
bis(4-fluorophenyl)-[1-(3-phenoxypropyl)piperidin-4-yl]methanol;oxalic acid (PubChem CID 23036403) has the molecular formula C29H31F2NO6 and a molecular weight of 527.56 g/mol. Its IUPAC name is bis(4-fluorophenyl)-[1-(3-phenoxypropyl)piperidin-4-yl]methanol;oxalic acid.
| Compound Name | bis(4-fluorophenyl)-[1-(3-phenoxypropyl)piperidin-4-yl]methanol;oxalic acid |
|---|---|
| PubChem CID | 23036403 |
| Molecular Formula | C29H31F2NO6 |
| Molecular Weight | 527.56 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | bis(4-fluorophenyl)-[1-(3-phenoxypropyl)piperidin-4-yl]methanol;oxalic acid |
| SMILES | O=C(O)C(=O)O.OC(c1ccc(F)cc1)(c1ccc(F)cc1)C1CCN(CCCOc2ccccc2)CC1 |
| InChI | InChI=1S/C27H29F2NO2.C2H2O4/c28-24-11-7-21(8-12-24)27(31,22-9-13-25(29)14-10-22)23-15-18-30(19-16-23)17-4-20-32-26-5-2-1-3-6-26;3-1(4)2(5)6/h1-3,5-14,23,31H,4,15-20H2;(H,3,4)(H,5,6) |
| InChIKey | QYFDDAQLAKUXHU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.56 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|