C30H32FNO6 — CID 19983080
2-[4-[3-[4-[(4-fluorophenyl)-hydroxy-phenylmethyl]piperidin-1-yl]propoxy]-3-methoxyphenyl]-2-oxoacetic acid (PubChem CID 19983080) has the molecular formula C30H32FNO6 and a molecular weight of 521.59 g/mol. Its IUPAC name is 2-[4-[3-[4-[(4-fluorophenyl)-hydroxy-phenylmethyl]piperidin-1-yl]propoxy]-3-methoxyphenyl]-2-oxoacetic acid.
| Compound Name | 2-[4-[3-[4-[(4-fluorophenyl)-hydroxy-phenylmethyl]piperidin-1-yl]propoxy]-3-methoxyphenyl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 19983080 |
| Molecular Formula | C30H32FNO6 |
| Molecular Weight | 521.59 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | 2-[4-[3-[4-[(4-fluorophenyl)-hydroxy-phenylmethyl]piperidin-1-yl]propoxy]-3-methoxyphenyl]-2-oxoacetic acid |
| SMILES | COc1cc(C(=O)C(=O)O)ccc1OCCCN1CCC(C(O)(c2ccccc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C30H32FNO6/c1-37-27-20-21(28(33)29(34)35)8-13-26(27)38-19-5-16-32-17-14-24(15-18-32)30(36,22-6-3-2-4-7-22)23-9-11-25(31)12-10-23/h2-4,6-13,20,24,36H,5,14-19H2,1H3,(H,34,35) |
| InChIKey | AHCFPQGMEOTYGV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.59 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|