C32H32F2N2O4 — CID 19983056
2,2-bis(4-fluorophenyl)-2-[1-[3-[2-methoxy-4-(3-oxobutanoyl)phenoxy]propyl]pyrrolidin-3-yl]acetonitrile (PubChem CID 19983056) has the molecular formula C32H32F2N2O4 and a molecular weight of 546.61 g/mol. Its IUPAC name is 2,2-bis(4-fluorophenyl)-2-[1-[3-[2-methoxy-4-(3-oxobutanoyl)phenoxy]propyl]pyrrolidin-3-yl]acetonitrile.
| Compound Name | 2,2-bis(4-fluorophenyl)-2-[1-[3-[2-methoxy-4-(3-oxobutanoyl)phenoxy]propyl]pyrrolidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 19983056 |
| Molecular Formula | C32H32F2N2O4 |
| Molecular Weight | 546.61 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | 2,2-bis(4-fluorophenyl)-2-[1-[3-[2-methoxy-4-(3-oxobutanoyl)phenoxy]propyl]pyrrolidin-3-yl]acetonitrile |
| SMILES | COc1cc(C(=O)CC(C)=O)ccc1OCCCN1CCC(C(C#N)(c2ccc(F)cc2)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C32H32F2N2O4/c1-22(37)18-29(38)23-4-13-30(31(19-23)39-2)40-17-3-15-36-16-14-26(20-36)32(21-35,24-5-9-27(33)10-6-24)25-7-11-28(34)12-8-25/h4-13,19,26H,3,14-18,20H2,1-2H3 |
| InChIKey | BBFVENRPWPLTIW-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.61 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|