C33H45FN2O3 — CID 19747842
2-(3,4-dimethoxyphenyl)-2-[3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl]decanenitrile (PubChem CID 19747842) has the molecular formula C33H45FN2O3 and a molecular weight of 536.73 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-2-[3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl]decanenitrile.
| Compound Name | 2-(3,4-dimethoxyphenyl)-2-[3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl]decanenitrile |
|---|---|
| PubChem CID | 19747842 |
| Molecular Formula | C33H45FN2O3 |
| Molecular Weight | 536.73 g/mol |
| Exact Mass | 536.34 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-2-[3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl]decanenitrile |
| SMILES | CCCCCCCCC(C#N)(CCCN1CCC(C(=O)c2ccc(F)cc2)CC1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C33H45FN2O3/c1-4-5-6-7-8-9-19-33(25-35,28-13-16-30(38-2)31(24-28)39-3)20-10-21-36-22-17-27(18-23-36)32(37)26-11-14-29(34)15-12-26/h11-16,24,27H,4-10,17-23H2,1-3H3 |
| InChIKey | DOVXVYSUUUDSGR-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.73 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|