C27H30ClNO2 — CID 44907120
[1-[3-(4-chlorophenoxy)propyl]piperidin-4-yl]-diphenylmethanol (PubChem CID 44907120) has the molecular formula C27H30ClNO2 and a molecular weight of 436.00 g/mol. Its IUPAC name is [1-[3-(4-chlorophenoxy)propyl]piperidin-4-yl]-diphenylmethanol.
| Compound Name | [1-[3-(4-chlorophenoxy)propyl]piperidin-4-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 44907120 |
| Molecular Formula | C27H30ClNO2 |
| Molecular Weight | 436.00 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | [1-[3-(4-chlorophenoxy)propyl]piperidin-4-yl]-diphenylmethanol |
| SMILES | OC(c1ccccc1)(c1ccccc1)C1CCN(CCCOc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C27H30ClNO2/c28-25-12-14-26(15-13-25)31-21-7-18-29-19-16-24(17-20-29)27(30,22-8-3-1-4-9-22)23-10-5-2-6-11-23/h1-6,8-15,24,30H,7,16-21H2 |
| InChIKey | ZNPOXTWCYGKAHQ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.00 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|