C27H30ClNO3 — CID 53464119
(2S)-1-(4-chlorophenoxy)-3-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]propan-2-ol (PubChem CID 53464119) has the molecular formula C27H30ClNO3 and a molecular weight of 451.99 g/mol. Its IUPAC name is (2S)-1-(4-chlorophenoxy)-3-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]propan-2-ol.
| Compound Name | (2S)-1-(4-chlorophenoxy)-3-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 53464119 |
| Molecular Formula | C27H30ClNO3 |
| Molecular Weight | 451.99 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | (2S)-1-(4-chlorophenoxy)-3-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]propan-2-ol |
| SMILES | O[C@H](COc1ccc(Cl)cc1)CN1CCC(C(O)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H30ClNO3/c28-24-11-13-26(14-12-24)32-20-25(30)19-29-17-15-23(16-18-29)27(31,21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1-14,23,25,30-31H,15-20H2/t25-/m0/s1 |
| InChIKey | QFQYGTAAFWPYKC-VWLOTQADSA-N |
| XLogP | 4.73 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.99 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |