C29H35NO3 — CID 54669647
[1-[3-(3-methoxyphenoxy)-2-methylpropyl]piperidin-4-yl]-diphenylmethanol (PubChem CID 54669647) has the molecular formula C29H35NO3 and a molecular weight of 445.60 g/mol. Its IUPAC name is [1-[3-(3-methoxyphenoxy)-2-methylpropyl]piperidin-4-yl]-diphenylmethanol.
| Compound Name | [1-[3-(3-methoxyphenoxy)-2-methylpropyl]piperidin-4-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 54669647 |
| Molecular Formula | C29H35NO3 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | [1-[3-(3-methoxyphenoxy)-2-methylpropyl]piperidin-4-yl]-diphenylmethanol |
| SMILES | COc1cccc(OCC(C)CN2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C29H35NO3/c1-23(22-33-28-15-9-14-27(20-28)32-2)21-30-18-16-26(17-19-30)29(31,24-10-5-3-6-11-24)25-12-7-4-8-13-25/h3-15,20,23,26,31H,16-19,21-22H2,1-2H3 |
| InChIKey | BIZKKKDFUXKZFO-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |