C30H33BrF3NO4 — CID 53300859
[1-[3-(4-bromo-3-methylphenoxy)propyl]piperidin-4-yl]-diphenylmethanol;2,2,2-trifluoroacetic acid (PubChem CID 53300859) has the molecular formula C30H33BrF3NO4 and a molecular weight of 608.50 g/mol. Its IUPAC name is [1-[3-(4-bromo-3-methylphenoxy)propyl]piperidin-4-yl]-diphenylmethanol;2,2,2-trifluoroacetic acid.
| Compound Name | [1-[3-(4-bromo-3-methylphenoxy)propyl]piperidin-4-yl]-diphenylmethanol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 53300859 |
| Molecular Formula | C30H33BrF3NO4 |
| Molecular Weight | 608.50 g/mol |
| Exact Mass | 607.15 |
| IUPAC Name | [1-[3-(4-bromo-3-methylphenoxy)propyl]piperidin-4-yl]-diphenylmethanol;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(OCCCN2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)ccc1Br.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H32BrNO2.C2HF3O2/c1-22-21-26(13-14-27(22)29)32-20-8-17-30-18-15-25(16-19-30)28(31,23-9-4-2-5-10-23)24-11-6-3-7-12-24;3-2(4,5)1(6)7/h2-7,9-14,21,25,31H,8,15-20H2,1H3;(H,6,7) |
| InChIKey | ZLWQAJHEEUJHEC-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.50 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|