C25H33NO2S — CID 139675543
O-ethyl 5-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]pentanethioate (PubChem CID 139675543) has the molecular formula C25H33NO2S and a molecular weight of 411.61 g/mol. Its IUPAC name is O-ethyl 5-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]pentanethioate.
| Compound Name | O-ethyl 5-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]pentanethioate |
|---|---|
| PubChem CID | 139675543 |
| Molecular Formula | C25H33NO2S |
| Molecular Weight | 411.61 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | O-ethyl 5-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]pentanethioate |
| SMILES | CCOC(=S)CCCCN1CCC(C(O)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C25H33NO2S/c1-2-28-24(29)15-9-10-18-26-19-16-23(17-20-26)25(27,21-11-5-3-6-12-21)22-13-7-4-8-14-22/h3-8,11-14,23,27H,2,9-10,15-20H2,1H3 |
| InChIKey | ICLBUBXIFQFSPX-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.61 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|