C34H47NO3 — CID 66603923
1-(4-tert-butylphenyl)-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butan-1-ol;ethanol (PubChem CID 66603923) has the molecular formula C34H47NO3 and a molecular weight of 517.75 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butan-1-ol;ethanol.
| Compound Name | 1-(4-tert-butylphenyl)-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butan-1-ol;ethanol |
|---|---|
| PubChem CID | 66603923 |
| Molecular Formula | C34H47NO3 |
| Molecular Weight | 517.75 g/mol |
| Exact Mass | 517.36 |
| IUPAC Name | 1-(4-tert-butylphenyl)-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butan-1-ol;ethanol |
| SMILES | CC(C)(C)c1ccc(C(O)CCCN2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1.CCO |
| InChI | InChI=1S/C32H41NO2.C2H6O/c1-31(2,3)26-18-16-25(17-19-26)30(34)15-10-22-33-23-20-29(21-24-33)32(35,27-11-6-4-7-12-27)28-13-8-5-9-14-28;1-2-3/h4-9,11-14,16-19,29-30,34-35H,10,15,20-24H2,1-3H3;3H,2H2,1H3 |
| InChIKey | LWUPPRMRMFKAIK-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.75 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |