C31H39NO2 — CID 15788976
1-(4-tert-butylphenyl)-3-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]propan-1-ol (PubChem CID 15788976) has the molecular formula C31H39NO2 and a molecular weight of 457.66 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]propan-1-ol.
| Compound Name | 1-(4-tert-butylphenyl)-3-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 15788976 |
| Molecular Formula | C31H39NO2 |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 457.30 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]propan-1-ol |
| SMILES | CC(C)(C)c1ccc(C(O)CCN2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C31H39NO2/c1-30(2,3)25-16-14-24(15-17-25)29(33)20-23-32-21-18-28(19-22-32)31(34,26-10-6-4-7-11-26)27-12-8-5-9-13-27/h4-17,28-29,33-34H,18-23H2,1-3H3 |
| InChIKey | ALESALWALCAOCC-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |