C33H41NO3 — CID 89189674
3-[4-[1-hydroxy-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butyl]phenyl]-3-methylbut-1-en-2-ol (PubChem CID 89189674) has the molecular formula C33H41NO3 and a molecular weight of 499.70 g/mol. Its IUPAC name is 3-[4-[1-hydroxy-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butyl]phenyl]-3-methylbut-1-en-2-ol.
| Compound Name | 3-[4-[1-hydroxy-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butyl]phenyl]-3-methylbut-1-en-2-ol |
|---|---|
| PubChem CID | 89189674 |
| Molecular Formula | C33H41NO3 |
| Molecular Weight | 499.70 g/mol |
| Exact Mass | 499.31 |
| IUPAC Name | 3-[4-[1-hydroxy-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butyl]phenyl]-3-methylbut-1-en-2-ol |
| SMILES | C=C(O)C(C)(C)c1ccc(C(O)CCCN2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C33H41NO3/c1-25(35)32(2,3)27-18-16-26(17-19-27)31(36)15-10-22-34-23-20-30(21-24-34)33(37,28-11-6-4-7-12-28)29-13-8-5-9-14-29/h4-9,11-14,16-19,30-31,35-37H,1,10,15,20-24H2,2-3H3 |
| InChIKey | DNWZTFBWOUQPFT-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.70 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|