C32H41NO3 — CID 141172906
1-[4-(1-hydroxybutan-2-yl)phenyl]-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butan-1-ol (PubChem CID 141172906) has the molecular formula C32H41NO3 and a molecular weight of 487.68 g/mol. Its IUPAC name is 1-[4-(1-hydroxybutan-2-yl)phenyl]-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butan-1-ol.
| Compound Name | 1-[4-(1-hydroxybutan-2-yl)phenyl]-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butan-1-ol |
|---|---|
| PubChem CID | 141172906 |
| Molecular Formula | C32H41NO3 |
| Molecular Weight | 487.68 g/mol |
| Exact Mass | 487.31 |
| IUPAC Name | 1-[4-(1-hydroxybutan-2-yl)phenyl]-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butan-1-ol |
| SMILES | CCC(CO)c1ccc(C(O)CCCN2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C32H41NO3/c1-2-25(24-34)26-15-17-27(18-16-26)31(35)14-9-21-33-22-19-30(20-23-33)32(36,28-10-5-3-6-11-28)29-12-7-4-8-13-29/h3-8,10-13,15-18,25,30-31,34-36H,2,9,14,19-24H2,1H3 |
| InChIKey | FLOXINGQOIJPIU-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.68 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |