C33H43NO3 — CID 141172908
9-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]-2-phenylnonane-1,6-diol (PubChem CID 141172908) has the molecular formula C33H43NO3 and a molecular weight of 501.71 g/mol. Its IUPAC name is 9-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]-2-phenylnonane-1,6-diol.
| Compound Name | 9-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]-2-phenylnonane-1,6-diol |
|---|---|
| PubChem CID | 141172908 |
| Molecular Formula | C33H43NO3 |
| Molecular Weight | 501.71 g/mol |
| Exact Mass | 501.32 |
| IUPAC Name | 9-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]-2-phenylnonane-1,6-diol |
| SMILES | OCC(CCCC(O)CCCN1CCC(C(O)(c2ccccc2)c2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C33H43NO3/c35-26-28(27-12-4-1-5-13-27)14-10-19-32(36)20-11-23-34-24-21-31(22-25-34)33(37,29-15-6-2-7-16-29)30-17-8-3-9-18-30/h1-9,12-13,15-18,28,31-32,35-37H,10-11,14,19-26H2 |
| InChIKey | XSQGDDYVPHFWII-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.71 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |