C37H45NO6 — CID 134872458
diethyl 2-ethyl-2-[4-[4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butanoyl]phenyl]propanedioate (PubChem CID 134872458) has the molecular formula C37H45NO6 and a molecular weight of 599.77 g/mol. Its IUPAC name is diethyl 2-ethyl-2-[4-[4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butanoyl]phenyl]propanedioate.
| Compound Name | diethyl 2-ethyl-2-[4-[4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butanoyl]phenyl]propanedioate |
|---|---|
| PubChem CID | 134872458 |
| Molecular Formula | C37H45NO6 |
| Molecular Weight | 599.77 g/mol |
| Exact Mass | 599.32 |
| IUPAC Name | diethyl 2-ethyl-2-[4-[4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butanoyl]phenyl]propanedioate |
| SMILES | CCOC(=O)C(CC)(C(=O)OCC)c1ccc(C(=O)CCCN2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C37H45NO6/c1-4-36(34(40)43-5-2,35(41)44-6-3)29-21-19-28(20-22-29)33(39)18-13-25-38-26-23-32(24-27-38)37(42,30-14-9-7-10-15-30)31-16-11-8-12-17-31/h7-12,14-17,19-22,32,42H,4-6,13,18,23-27H2,1-3H3 |
| InChIKey | LQYFYNPHGLZXOF-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.77 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|