About 5-[4-[hydroxy-bis(4-methylphenyl)methyl]piperidin-1-yl]-N,N-dimethylpentanamide
5-[4-[hydroxy-bis(4-methylphenyl)methyl]piperidin-1-yl]-N,N-dimethylpentanamide (PubChem CID 19992273) has the molecular formula C27H38N2O2
and a molecular weight of 422.61 g/mol. Its IUPAC name is 5-[4-[hydroxy-bis(4-methylphenyl)methyl]piperidin-1-yl]-N,N-dimethylpentanamide.
Molecular Properties
| Compound Name | 5-[4-[hydroxy-bis(4-methylphenyl)methyl]piperidin-1-yl]-N,N-dimethylpentanamide |
| PubChem CID | 19992273 |
| Molecular Formula | C27H38N2O2 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | 5-[4-[hydroxy-bis(4-methylphenyl)methyl]piperidin-1-yl]-N,N-dimethylpentanamide |
| SMILES | Cc1ccc(C(O)(c2ccc(C)cc2)C2CCN(CCCCC(=O)N(C)C)CC2)cc1 |
| InChI | InChI=1S/C27H38N2O2/c1-21-8-12-23(13-9-21)27(31,24-14-10-22(2)11-15-24)25-16-19-29(20-17-25)18-6-5-7-26(30)28(3)4/h8-15,25,31H,5-7,16-20H2,1-4H3 |
| InChIKey | RXJCSQCRAANGAK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-[hydroxy-bis(4-methylphenyl)methyl]piperidin-1-yl]-N,N-dimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-[hydroxy-bis(4-methylphenyl)methyl]piperidin-1-yl]-N,N-dimethylpentanamide?
The IUPAC name of 5-[4-[hydroxy-bis(4-methylphenyl)methyl]piperidin-1-yl]-N,N-dimethylpentanamide (CID 19992273) is 5-[4-[hydroxy-bis(4-methylphenyl)methyl]piperidin-1-yl]-N,N-dimethylpentanamide.
What is the SMILES notation for 5-[4-[hydroxy-bis(4-methylphenyl)methyl]piperidin-1-yl]-N,N-dimethylpentanamide?
The canonical SMILES for 5-[4-[hydroxy-bis(4-methylphenyl)methyl]piperidin-1-yl]-N,N-dimethylpentanamide is Cc1ccc(C(O)(c2ccc(C)cc2)C2CCN(CCCCC(=O)N(C)C)CC2)cc1.
What is the InChIKey of 5-[4-[hydroxy-bis(4-methylphenyl)methyl]piperidin-1-yl]-N,N-dimethylpentanamide?
The InChIKey is RXJCSQCRAANGAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H38N2O2/c1-21-8-12-23(13-9-21)27(31,24-14-10-22(2)11-15-24)25-16-19-29(20-17-25)18-6-5-7-26(30)28(3)4/h8-15,25,31H,5-7,16-20H2,1-4H3.
What are the key properties of 5-[4-[hydroxy-bis(4-methylphenyl)methyl]piperidin-1-yl]-N,N-dimethylpentanamide?
5-[4-[hydroxy-bis(4-methylphenyl)methyl]piperidin-1-yl]-N,N-dimethylpentanamide has a molecular weight of 422.61 g/mol, XLogP of 4.51, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-[hydroxy-bis(4-methylphenyl)methyl]piperidin-1-yl]-N,N-dimethylpentanamide is sourced from PubChem (CID 19992273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).