C28H40N2O4 — CID 19992327
6-[4-[hydroxy-bis(4-methoxyphenyl)methyl]piperidin-1-yl]-N,N-dimethylhexanamide (PubChem CID 19992327) has the molecular formula C28H40N2O4 and a molecular weight of 468.64 g/mol. Its IUPAC name is 6-[4-[hydroxy-bis(4-methoxyphenyl)methyl]piperidin-1-yl]-N,N-dimethylhexanamide.
| Compound Name | 6-[4-[hydroxy-bis(4-methoxyphenyl)methyl]piperidin-1-yl]-N,N-dimethylhexanamide |
|---|---|
| PubChem CID | 19992327 |
| Molecular Formula | C28H40N2O4 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.30 |
| IUPAC Name | 6-[4-[hydroxy-bis(4-methoxyphenyl)methyl]piperidin-1-yl]-N,N-dimethylhexanamide |
| SMILES | COc1ccc(C(O)(c2ccc(OC)cc2)C2CCN(CCCCCC(=O)N(C)C)CC2)cc1 |
| InChI | InChI=1S/C28H40N2O4/c1-29(2)27(31)8-6-5-7-19-30-20-17-24(18-21-30)28(32,22-9-13-25(33-3)14-10-22)23-11-15-26(34-4)16-12-23/h9-16,24,32H,5-8,17-21H2,1-4H3 |
| InChIKey | BJCMUWGHQFMIHS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|